About 5-pyrazin-2-yltetrazine
5-pyrazin-2-yltetrazine (PubChem CID 66671872) has the molecular formula C6H4N6
and a molecular weight of 160.14 g/mol. Its IUPAC name is 5-pyrazin-2-yltetrazine.
Molecular Properties
| Compound Name | 5-pyrazin-2-yltetrazine |
| PubChem CID | 66671872 |
| Molecular Formula | C6H4N6 |
| Molecular Weight | 160.14 g/mol |
| Exact Mass | 160.05 |
| IUPAC Name | 5-pyrazin-2-yltetrazine |
| SMILES | c1cnc(-c2cnnnn2)cn1 |
| InChI | InChI=1S/C6H4N6/c1-2-8-5(3-7-1)6-4-9-11-12-10-6/h1-4H |
| InChIKey | XIOKPKHXAMWTPY-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.14 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-pyrazin-2-yltetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrazin-2-yltetrazine?
The IUPAC name of 5-pyrazin-2-yltetrazine (CID 66671872) is 5-pyrazin-2-yltetrazine.
What is the SMILES notation for 5-pyrazin-2-yltetrazine?
The canonical SMILES for 5-pyrazin-2-yltetrazine is c1cnc(-c2cnnnn2)cn1.
What is the InChIKey of 5-pyrazin-2-yltetrazine?
The InChIKey is XIOKPKHXAMWTPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N6/c1-2-8-5(3-7-1)6-4-9-11-12-10-6/h1-4H.
What are the key properties of 5-pyrazin-2-yltetrazine?
5-pyrazin-2-yltetrazine has a molecular weight of 160.14 g/mol, XLogP of -0.28, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrazin-2-yltetrazine is sourced from PubChem (CID 66671872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).