C28H37NO8S — CID 6667190
[(2S,4S)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)methanone (PubChem CID 6667190) has the molecular formula C28H37NO8S and a molecular weight of 547.67 g/mol. Its IUPAC name is [(2S,4S)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)methanone.
| Compound Name | [(2S,4S)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)methanone |
|---|---|
| PubChem CID | 6667190 |
| Molecular Formula | C28H37NO8S |
| Molecular Weight | 547.67 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | [(2S,4S)-2-[[4-(hydroxymethyl)phenyl]methoxy]-4-thiophen-3-yl-3,4-dihydro-2H-pyran-6-yl]-(1,4,7,10-tetraoxa-13-azacyclopentadec-13-yl)methanone |
| SMILES | O=C(C1=C[C@@H](c2ccsc2)C[C@@H](OCc2ccc(CO)cc2)O1)N1CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C28H37NO8S/c30-19-22-1-3-23(4-2-22)20-36-27-18-25(24-5-16-38-21-24)17-26(37-27)28(31)29-6-8-32-10-12-34-14-15-35-13-11-33-9-7-29/h1-5,16-17,21,25,27,30H,6-15,18-20H2/t25-,27+/m1/s1 |
| InChIKey | RNJLMXXXTLDYBN-VPUSJEBWSA-N |
| XLogP | 3.08 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.67 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |