C11H11BrClN3O2 — CID 66671923
1-[(2-bromo-4-chlorobenzoyl)amino]-1-prop-2-enylurea (PubChem CID 66671923) has the molecular formula C11H11BrClN3O2 and a molecular weight of 332.59 g/mol. Its IUPAC name is 1-[(2-bromo-4-chlorobenzoyl)amino]-1-prop-2-enylurea.
| Compound Name | 1-[(2-bromo-4-chlorobenzoyl)amino]-1-prop-2-enylurea |
|---|---|
| PubChem CID | 66671923 |
| Molecular Formula | C11H11BrClN3O2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 1-[(2-bromo-4-chlorobenzoyl)amino]-1-prop-2-enylurea |
| SMILES | C=CCN(NC(=O)c1ccc(Cl)cc1Br)C(N)=O |
| InChI | InChI=1S/C11H11BrClN3O2/c1-2-5-16(11(14)18)15-10(17)8-4-3-7(13)6-9(8)12/h2-4,6H,1,5H2,(H2,14,18)(H,15,17) |
| InChIKey | FSRPRDDNDGHXOJ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|