About 4-bromo-N,N,2-triethylaniline
4-bromo-N,N,2-triethylaniline (PubChem CID 66672004) has the molecular formula C12H18BrN
and a molecular weight of 256.19 g/mol. Its IUPAC name is 4-bromo-N,N,2-triethylaniline.
Molecular Properties
| Compound Name | 4-bromo-N,N,2-triethylaniline |
| PubChem CID | 66672004 |
| Molecular Formula | C12H18BrN |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 4-bromo-N,N,2-triethylaniline |
| SMILES | CCc1cc(Br)ccc1N(CC)CC |
| InChI | InChI=1S/C12H18BrN/c1-4-10-9-11(13)7-8-12(10)14(5-2)6-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | KRMXDCZSRUIPRP-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-N,N,2-triethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N,N,2-triethylaniline?
The IUPAC name of 4-bromo-N,N,2-triethylaniline (CID 66672004) is 4-bromo-N,N,2-triethylaniline.
What is the SMILES notation for 4-bromo-N,N,2-triethylaniline?
The canonical SMILES for 4-bromo-N,N,2-triethylaniline is CCc1cc(Br)ccc1N(CC)CC.
What is the InChIKey of 4-bromo-N,N,2-triethylaniline?
The InChIKey is KRMXDCZSRUIPRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18BrN/c1-4-10-9-11(13)7-8-12(10)14(5-2)6-3/h7-9H,4-6H2,1-3H3.
What are the key properties of 4-bromo-N,N,2-triethylaniline?
4-bromo-N,N,2-triethylaniline has a molecular weight of 256.19 g/mol, XLogP of 3.86, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N,N,2-triethylaniline is sourced from PubChem (CID 66672004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).