C25H30FN7O7S — CID 66672069
(2S)-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]propanoic acid (PubChem CID 66672069) has the molecular formula C25H30FN7O7S and a molecular weight of 591.62 g/mol. Its IUPAC name is (2S)-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 66672069 |
| Molecular Formula | C25H30FN7O7S |
| Molecular Weight | 591.62 g/mol |
| Exact Mass | 591.19 |
| IUPAC Name | (2S)-3-[[3-fluoro-4-[4-(1,4,5,6-tetrahydropyrimidin-2-ylamino)piperidin-1-yl]benzoyl]amino]-2-[(4-nitrophenyl)sulfonylamino]propanoic acid |
| SMILES | O=C(NC[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)O)c1ccc(N2CCC(NC3=NCCCN3)CC2)c(F)c1 |
| InChI | InChI=1S/C25H30FN7O7S/c26-20-14-16(2-7-22(20)32-12-8-17(9-13-32)30-25-27-10-1-11-28-25)23(34)29-15-21(24(35)36)31-41(39,40)19-5-3-18(4-6-19)33(37)38/h2-7,14,17,21,31H,1,8-13,15H2,(H,29,34)(H,35,36)(H2,27,28,30)/t21-/m0/s1 |
| InChIKey | RYQNLMVKBISGJJ-NRFANRHFSA-N |
| XLogP | 0.80 |
| TPSA | 195.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.62 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|