C14H22N2O3 — CID 66672660
[(2R)-2-acetamido-2-methyl-4-(1-methylpyrrol-2-yl)butyl] acetate (PubChem CID 66672660) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(2R)-2-acetamido-2-methyl-4-(1-methylpyrrol-2-yl)butyl] acetate.
| Compound Name | [(2R)-2-acetamido-2-methyl-4-(1-methylpyrrol-2-yl)butyl] acetate |
|---|---|
| PubChem CID | 66672660 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | [(2R)-2-acetamido-2-methyl-4-(1-methylpyrrol-2-yl)butyl] acetate |
| SMILES | CC(=O)N[C@](C)(CCc1cccn1C)COC(C)=O |
| InChI | InChI=1S/C14H22N2O3/c1-11(17)15-14(3,10-19-12(2)18)8-7-13-6-5-9-16(13)4/h5-6,9H,7-8,10H2,1-4H3,(H,15,17)/t14-/m1/s1 |
| InChIKey | APDQUSJIHZTDTI-CQSZACIVSA-N |
| XLogP | 1.42 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |