C17H29N — CID 66673098
2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,2,3,5,6,7-hexahydroindolizine (PubChem CID 66673098) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,2,3,5,6,7-hexahydroindolizine.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,2,3,5,6,7-hexahydroindolizine |
|---|---|
| PubChem CID | 66673098 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;1,2,3,5,6,7-hexahydroindolizine |
| SMILES | C1=C2CCCN2CCC1.C1CCC2CCCC2C1 |
| InChI | InChI=1S/C9H16.C8H13N/c1-2-5-9-7-3-6-8(9)4-1;1-2-6-9-7-3-5-8(9)4-1/h8-9H,1-7H2;4H,1-3,5-7H2 |
| InChIKey | GZGHLWSTQVCUGD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |