About 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one
2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one (PubChem CID 66674085) has the molecular formula C26H25ClN2O4
and a molecular weight of 464.95 g/mol. Its IUPAC name is 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one.
Molecular Properties
| Compound Name | 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
| PubChem CID | 66674085 |
| Molecular Formula | C26H25ClN2O4 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one |
| SMILES | CCOC1(Cl)C=CC(n2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)cc2=O)=CC1 |
| InChI | InChI=1S/C26H25ClN2O4/c1-4-33-26(27)15-13-20(14-16-26)29-24(30)17-23(18-5-9-21(31-2)10-6-18)25(28-29)19-7-11-22(32-3)12-8-19/h5-15,17H,4,16H2,1-3H3 |
| InChIKey | CHOIHOSEEMGDLV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
The IUPAC name of 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one (CID 66674085) is 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one.
What is the SMILES notation for 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
The canonical SMILES for 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one is CCOC1(Cl)C=CC(n2nc(-c3ccc(OC)cc3)c(-c3ccc(OC)cc3)cc2=O)=CC1.
What is the InChIKey of 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
The InChIKey is CHOIHOSEEMGDLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25ClN2O4/c1-4-33-26(27)15-13-20(14-16-26)29-24(30)17-23(18-5-9-21(31-2)10-6-18)25(28-29)19-7-11-22(32-3)12-8-19/h5-15,17H,4,16H2,1-3H3.
What are the key properties of 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one?
2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one has a molecular weight of 464.95 g/mol, XLogP of 5.37, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chloro-4-ethoxycyclohexa-1,5-dien-1-yl)-5,6-bis(4-methoxyphenyl)pyridazin-3-one is sourced from PubChem (CID 66674085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).