C2H2K2N2S3 — CID 66674087
1,3,4-Thiadiazole-2,5-dithiol dipotassium salt (PubChem CID 66674087) has the molecular formula C2H2K2N2S3 and a molecular weight of 228.45 g/mol.
| Compound Name | 1,3,4-Thiadiazole-2,5-dithiol dipotassium salt |
|---|---|
| PubChem CID | 66674087 |
| Molecular Formula | C2H2K2N2S3 |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 227.87 |
| IUPAC Name | — |
| SMILES | S=c1[nH][nH]c(=S)s1.[K].[K] |
| InChI | InChI=1S/C2H2N2S3.2K/c5-1-3-4-2(6)7-1;;/h(H,3,5)(H,4,6);; |
| InChIKey | APBOZDGTRCWHKW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|