About potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate
potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate (PubChem CID 66674121) has the molecular formula C13H23KO4
and a molecular weight of 282.42 g/mol. Its IUPAC name is potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate.
Molecular Properties
| Compound Name | potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate |
| PubChem CID | 66674121 |
| Molecular Formula | C13H23KO4 |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate |
| SMILES | COC(C[C@H](CC1CCCCC1)C(=O)[O-])OC.[K+] |
| InChI | InChI=1S/C13H24O4.K/c1-16-12(17-2)9-11(13(14)15)8-10-6-4-3-5-7-10;/h10-12H,3-9H2,1-2H3,(H,14,15);/q;+1/p-1/t11-;/m0./s1 |
| InChIKey | KRNKGEGPCOEYGS-MERQFXBCSA-M |
| XLogP | -1.66 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate?
The IUPAC name of potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate (CID 66674121) is potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate.
What is the SMILES notation for potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate?
The canonical SMILES for potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate is COC(C[C@H](CC1CCCCC1)C(=O)[O-])OC.[K+].
What is the InChIKey of potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate?
The InChIKey is KRNKGEGPCOEYGS-MERQFXBCSA-M. The full InChI is InChI=1S/C13H24O4.K/c1-16-12(17-2)9-11(13(14)15)8-10-6-4-3-5-7-10;/h10-12H,3-9H2,1-2H3,(H,14,15);/q;+1/p-1/t11-;/m0./s1.
What are the key properties of potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate?
potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate has a molecular weight of 282.42 g/mol, XLogP of -1.66, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (2S)-2-(cyclohexylmethyl)-4,4-dimethoxybutanoate is sourced from PubChem (CID 66674121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).