C26H36N8O2 — CID 66674271
N-[(1S)-1-[5-(3-amino-1H-indazol-6-yl)-1H-imidazol-2-yl]-4-[cyclopropyl(methyl)amino]-4-oxobutyl]-4-(aminomethyl)cyclohexane-1-carboxamide (PubChem CID 66674271) has the molecular formula C26H36N8O2 and a molecular weight of 492.63 g/mol. Its IUPAC name is N-[(1S)-1-[5-(3-amino-1H-indazol-6-yl)-1H-imidazol-2-yl]-4-[cyclopropyl(methyl)amino]-4-oxobutyl]-4-(aminomethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(1S)-1-[5-(3-amino-1H-indazol-6-yl)-1H-imidazol-2-yl]-4-[cyclopropyl(methyl)amino]-4-oxobutyl]-4-(aminomethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 66674271 |
| Molecular Formula | C26H36N8O2 |
| Molecular Weight | 492.63 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | N-[(1S)-1-[5-(3-amino-1H-indazol-6-yl)-1H-imidazol-2-yl]-4-[cyclopropyl(methyl)amino]-4-oxobutyl]-4-(aminomethyl)cyclohexane-1-carboxamide |
| SMILES | CN(C(=O)CC[C@H](NC(=O)C1CCC(CN)CC1)c1ncc(-c2ccc3c(N)n[nH]c3c2)[nH]1)C1CC1 |
| InChI | InChI=1S/C26H36N8O2/c1-34(18-7-8-18)23(35)11-10-20(31-26(36)16-4-2-15(13-27)3-5-16)25-29-14-22(30-25)17-6-9-19-21(12-17)32-33-24(19)28/h6,9,12,14-16,18,20H,2-5,7-8,10-11,13,27H2,1H3,(H,29,30)(H,31,36)(H3,28,32,33)/t15?,16?,20-/m0/s1 |
| InChIKey | SUHZDRMEKMKQOR-PMTKGXAQSA-N |
| XLogP | 2.86 |
| TPSA | 158.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.63 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |