About methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate
methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate (PubChem CID 66674422) has the molecular formula C16H17BrFNO2
and a molecular weight of 354.22 g/mol. Its IUPAC name is methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate |
| PubChem CID | 66674422 |
| Molecular Formula | C16H17BrFNO2 |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 353.04 |
| IUPAC Name | methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c([C@@H]3CCCC[C@H]3F)c(Br)[nH]c2c1 |
| InChI | InChI=1S/C16H17BrFNO2/c1-21-16(20)9-6-7-11-13(8-9)19-15(17)14(11)10-4-2-3-5-12(10)18/h6-8,10,12,19H,2-5H2,1H3/t10-,12-/m1/s1 |
| InChIKey | FQQSJXAZKIBOKN-ZYHUDNBSSA-N |
| XLogP | 4.71 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate?
The IUPAC name of methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate (CID 66674422) is methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate.
What is the SMILES notation for methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate?
The canonical SMILES for methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate is COC(=O)c1ccc2c([C@@H]3CCCC[C@H]3F)c(Br)[nH]c2c1.
What is the InChIKey of methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate?
The InChIKey is FQQSJXAZKIBOKN-ZYHUDNBSSA-N. The full InChI is InChI=1S/C16H17BrFNO2/c1-21-16(20)9-6-7-11-13(8-9)19-15(17)14(11)10-4-2-3-5-12(10)18/h6-8,10,12,19H,2-5H2,1H3/t10-,12-/m1/s1.
What are the key properties of methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate?
methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate has a molecular weight of 354.22 g/mol, XLogP of 4.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-bromo-3-[(1S,2R)-2-fluorocyclohexyl]-1H-indole-6-carboxylate is sourced from PubChem (CID 66674422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).