C18H18N6O2 — CID 666745
4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1-(2-phenylethyl)piperazine-2,6-dione (PubChem CID 666745) has the molecular formula C18H18N6O2 and a molecular weight of 350.38 g/mol. Its IUPAC name is 4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1-(2-phenylethyl)piperazine-2,6-dione.
| Compound Name | 4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1-(2-phenylethyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 666745 |
| Molecular Formula | C18H18N6O2 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 4-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-1-(2-phenylethyl)piperazine-2,6-dione |
| SMILES | Cc1cc(N2CC(=O)N(CCc3ccccc3)C(=O)C2)n2ncnc2n1 |
| InChI | InChI=1S/C18H18N6O2/c1-13-9-15(24-18(21-13)19-12-20-24)22-10-16(25)23(17(26)11-22)8-7-14-5-3-2-4-6-14/h2-6,9,12H,7-8,10-11H2,1H3 |
| InChIKey | HCLLNKNCTGRTQE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|