About methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate
methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate (PubChem CID 66675245) has the molecular formula C20H17F3N2O2
and a molecular weight of 374.36 g/mol. Its IUPAC name is methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate |
| PubChem CID | 66675245 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C)c(-c2ccc3c(C(C)C(F)(F)F)nncc3c2)c1 |
| InChI | InChI=1S/C20H17F3N2O2/c1-11-4-5-14(19(26)27-3)9-17(11)13-6-7-16-15(8-13)10-24-25-18(16)12(2)20(21,22)23/h4-10,12H,1-3H3 |
| InChIKey | TXEALZHLJUWRSU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate?
The IUPAC name of methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate (CID 66675245) is methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate.
What is the SMILES notation for methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate?
The canonical SMILES for methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate is COC(=O)c1ccc(C)c(-c2ccc3c(C(C)C(F)(F)F)nncc3c2)c1.
What is the InChIKey of methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate?
The InChIKey is TXEALZHLJUWRSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N2O2/c1-11-4-5-14(19(26)27-3)9-17(11)13-6-7-16-15(8-13)10-24-25-18(16)12(2)20(21,22)23/h4-10,12H,1-3H3.
What are the key properties of methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate?
methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate has a molecular weight of 374.36 g/mol, XLogP of 5.06, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoate is sourced from PubChem (CID 66675245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).