About 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid
4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid (PubChem CID 66675461) has the molecular formula C19H15F3N2O2
and a molecular weight of 360.34 g/mol. Its IUPAC name is 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid |
| PubChem CID | 66675461 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccc2c(C(C)C(F)(F)F)nncc2c1 |
| InChI | InChI=1S/C19H15F3N2O2/c1-10-3-4-13(18(25)26)8-16(10)12-5-6-15-14(7-12)9-23-24-17(15)11(2)19(20,21)22/h3-9,11H,1-2H3,(H,25,26) |
| InChIKey | PONTXQNTQULMCE-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid?
The IUPAC name of 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid (CID 66675461) is 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid.
What is the SMILES notation for 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid?
The canonical SMILES for 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid is Cc1ccc(C(=O)O)cc1-c1ccc2c(C(C)C(F)(F)F)nncc2c1.
What is the InChIKey of 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid?
The InChIKey is PONTXQNTQULMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F3N2O2/c1-10-3-4-13(18(25)26)8-16(10)12-5-6-15-14(7-12)9-23-24-17(15)11(2)19(20,21)22/h3-9,11H,1-2H3,(H,25,26).
What are the key properties of 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid?
4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid has a molecular weight of 360.34 g/mol, XLogP of 4.97, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[1-(1,1,1-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid is sourced from PubChem (CID 66675461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).