C6H10O10S — CID 66675533
(2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;sulfuric acid (PubChem CID 66675533) has the molecular formula C6H10O10S and a molecular weight of 274.20 g/mol. Its IUPAC name is (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;sulfuric acid.
| Compound Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;sulfuric acid |
|---|---|
| PubChem CID | 66675533 |
| Molecular Formula | C6H10O10S |
| Molecular Weight | 274.20 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | (2R)-2-[(1S)-1,2-dihydroxyethyl]-3,4-dihydroxy-2H-furan-5-one;sulfuric acid |
| SMILES | O=C1O[C@H]([C@@H](O)CO)C(O)=C1O.O=S(=O)(O)O |
| InChI | InChI=1S/C6H8O6.H2O4S/c7-1-2(8)5-3(9)4(10)6(11)12-5;1-5(2,3)4/h2,5,7-10H,1H2;(H2,1,2,3,4)/t2-,5+;/m0./s1 |
| InChIKey | CGFPNELNAZZYQL-RXSVEWSESA-N |
| XLogP | -2.06 |
| TPSA | 181.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.20 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|