About 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide
2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide (PubChem CID 66675737) has the molecular formula C18H14F3N3O
and a molecular weight of 345.32 g/mol. Its IUPAC name is 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide.
Molecular Properties
| Compound Name | 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide |
| PubChem CID | 66675737 |
| Molecular Formula | C18H14F3N3O |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide |
| SMILES | C[C@H](c1nncc2cc(-c3ccccc3C(N)=O)ccc12)C(F)(F)F |
| InChI | InChI=1S/C18H14F3N3O/c1-10(18(19,20)21)16-14-7-6-11(8-12(14)9-23-24-16)13-4-2-3-5-15(13)17(22)25/h2-10H,1H3,(H2,22,25)/t10-/m1/s1 |
| InChIKey | OOVDBGZXERVBAM-SNVBAGLBSA-N |
| XLogP | 4.06 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide?
The IUPAC name of 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide (CID 66675737) is 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide.
What is the SMILES notation for 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide?
The canonical SMILES for 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide is C[C@H](c1nncc2cc(-c3ccccc3C(N)=O)ccc12)C(F)(F)F.
What is the InChIKey of 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide?
The InChIKey is OOVDBGZXERVBAM-SNVBAGLBSA-N. The full InChI is InChI=1S/C18H14F3N3O/c1-10(18(19,20)21)16-14-7-6-11(8-12(14)9-23-24-16)13-4-2-3-5-15(13)17(22)25/h2-10H,1H3,(H2,22,25)/t10-/m1/s1.
What are the key properties of 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide?
2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide has a molecular weight of 345.32 g/mol, XLogP of 4.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(2R)-1,1,1-trifluoropropan-2-yl]phthalazin-6-yl]benzamide is sourced from PubChem (CID 66675737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).