C45H51FN2O3 — CID 6667590
[(2S,5S,6S,13S)-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone (PubChem CID 6667590) has the molecular formula C45H51FN2O3 and a molecular weight of 686.91 g/mol. Its IUPAC name is [(2S,5S,6S,13S)-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone.
| Compound Name | [(2S,5S,6S,13S)-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 6667590 |
| Molecular Formula | C45H51FN2O3 |
| Molecular Weight | 686.91 g/mol |
| Exact Mass | 686.39 |
| IUPAC Name | [(2S,5S,6S,13S)-5-[[4-(4-fluorophenyl)piperazin-1-yl]methyl]-5,13-dihydroxy-6,10-dimethyl-17-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]-(4-phenylphenyl)methanone |
| SMILES | CC1=CCC[C@@]2(C)[C@@H](CC[C@@]2(O)CN2CCN(c3ccc(F)cc3)CC2)c2ccc(cc2C(=O)c2ccc(-c3ccccc3)cc2)C[C@@H](O)CC1 |
| InChI | InChI=1S/C45H51FN2O3/c1-32-7-6-23-44(2)42(22-24-45(44,51)31-47-25-27-48(28-26-47)38-18-16-37(46)17-19-38)40-21-11-33(29-39(49)20-10-32)30-41(40)43(50)36-14-12-35(13-15-36)34-8-4-3-5-9-34/h3-5,7-9,11-19,21,30,39,42,49,51H,6,10,20,22-29,31H2,1-2H3/t39-,42-,44-,45+/m0/s1 |
| InChIKey | JCYAJXVTCGFKRR-CRYJPXJJSA-N |
| XLogP | 8.58 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.91 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|