C19H15F3N2O2 — CID 66675911
4-methyl-3-[1-(1,1,3-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid (PubChem CID 66675911) has the molecular formula C19H15F3N2O2 and a molecular weight of 360.34 g/mol. Its IUPAC name is 4-methyl-3-[1-(1,1,3-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid.
| Compound Name | 4-methyl-3-[1-(1,1,3-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 66675911 |
| Molecular Formula | C19H15F3N2O2 |
| Molecular Weight | 360.34 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 4-methyl-3-[1-(1,1,3-trifluoropropan-2-yl)phthalazin-6-yl]benzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1-c1ccc2c(C(CF)C(F)F)nncc2c1 |
| InChI | InChI=1S/C19H15F3N2O2/c1-10-2-3-12(19(25)26)7-15(10)11-4-5-14-13(6-11)9-23-24-17(14)16(8-20)18(21)22/h2-7,9,16,18H,8H2,1H3,(H,25,26) |
| InChIKey | JDBVZENMYNRVIG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |