C15H17N3O3S — CID 666761
benzyl 4-hydroxy-N,1,3-trimethyl-2,6-dioxopyrimidine-5-carboximidothioate (PubChem CID 666761) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is benzyl 4-hydroxy-N,1,3-trimethyl-2,6-dioxopyrimidine-5-carboximidothioate.
| Compound Name | benzyl 4-hydroxy-N,1,3-trimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
|---|---|
| PubChem CID | 666761 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | benzyl 4-hydroxy-N,1,3-trimethyl-2,6-dioxopyrimidine-5-carboximidothioate |
| SMILES | C/N=C(\SCc1ccccc1)c1c(O)n(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C15H17N3O3S/c1-16-12(22-9-10-7-5-4-6-8-10)11-13(19)17(2)15(21)18(3)14(11)20/h4-8,19H,9H2,1-3H3/b16-12- |
| InChIKey | JYGYZWBOHXJAJU-VBKFSLOCSA-N |
| XLogP | 1.10 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|