C19H13N5O2 — CID 666762
11-methyl-2,6-dioxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile (PubChem CID 666762) has the molecular formula C19H13N5O2 and a molecular weight of 343.35 g/mol. Its IUPAC name is 11-methyl-2,6-dioxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile.
| Compound Name | 11-methyl-2,6-dioxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 666762 |
| Molecular Formula | C19H13N5O2 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 11-methyl-2,6-dioxo-7-(pyridin-3-ylmethyl)-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaene-5-carbonitrile |
| SMILES | Cc1cccn2c(=O)c3cc(C#N)c(=O)n(Cc4cccnc4)c3nc12 |
| InChI | InChI=1S/C19H13N5O2/c1-12-4-3-7-23-16(12)22-17-15(19(23)26)8-14(9-20)18(25)24(17)11-13-5-2-6-21-10-13/h2-8,10H,11H2,1H3 |
| InChIKey | YCWGZOQLMYAVCA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 93.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|