About 2-(1H-pyrazol-5-yl)-1,3,5-triazine
2-(1H-pyrazol-5-yl)-1,3,5-triazine (PubChem CID 66676329) has the molecular formula C6H5N5
and a molecular weight of 147.14 g/mol. Its IUPAC name is 2-(1H-pyrazol-5-yl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(1H-pyrazol-5-yl)-1,3,5-triazine |
| PubChem CID | 66676329 |
| Molecular Formula | C6H5N5 |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.05 |
| IUPAC Name | 2-(1H-pyrazol-5-yl)-1,3,5-triazine |
| SMILES | c1cc(-c2ncncn2)[nH]n1 |
| InChI | InChI=1S/C6H5N5/c1-2-10-11-5(1)6-8-3-7-4-9-6/h1-4H,(H,10,11) |
| InChIKey | DWGKRFLDSZNFJH-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-pyrazol-5-yl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrazol-5-yl)-1,3,5-triazine?
The IUPAC name of 2-(1H-pyrazol-5-yl)-1,3,5-triazine (CID 66676329) is 2-(1H-pyrazol-5-yl)-1,3,5-triazine.
What is the SMILES notation for 2-(1H-pyrazol-5-yl)-1,3,5-triazine?
The canonical SMILES for 2-(1H-pyrazol-5-yl)-1,3,5-triazine is c1cc(-c2ncncn2)[nH]n1.
What is the InChIKey of 2-(1H-pyrazol-5-yl)-1,3,5-triazine?
The InChIKey is DWGKRFLDSZNFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N5/c1-2-10-11-5(1)6-8-3-7-4-9-6/h1-4H,(H,10,11).
What are the key properties of 2-(1H-pyrazol-5-yl)-1,3,5-triazine?
2-(1H-pyrazol-5-yl)-1,3,5-triazine has a molecular weight of 147.14 g/mol, XLogP of 0.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrazol-5-yl)-1,3,5-triazine is sourced from PubChem (CID 66676329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).