C31H32FNO5 — CID 66676838
(2S,3R)-2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-5-[4-(4-fluorophenyl)phenyl]-3-hydroxypentanoic acid (PubChem CID 66676838) has the molecular formula C31H32FNO5 and a molecular weight of 517.60 g/mol. Its IUPAC name is (2S,3R)-2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-5-[4-(4-fluorophenyl)phenyl]-3-hydroxypentanoic acid.
| Compound Name | (2S,3R)-2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-5-[4-(4-fluorophenyl)phenyl]-3-hydroxypentanoic acid |
|---|---|
| PubChem CID | 66676838 |
| Molecular Formula | C31H32FNO5 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.23 |
| IUPAC Name | (2S,3R)-2-[2-(5-tert-butyl-1,3-dioxoisoindol-2-yl)ethyl]-5-[4-(4-fluorophenyl)phenyl]-3-hydroxypentanoic acid |
| SMILES | CC(C)(C)c1ccc2c(c1)C(=O)N(CC[C@H](C(=O)O)[C@H](O)CCc1ccc(-c3ccc(F)cc3)cc1)C2=O |
| InChI | InChI=1S/C31H32FNO5/c1-31(2,3)22-11-14-24-26(18-22)29(36)33(28(24)35)17-16-25(30(37)38)27(34)15-6-19-4-7-20(8-5-19)21-9-12-23(32)13-10-21/h4-5,7-14,18,25,27,34H,6,15-17H2,1-3H3,(H,37,38)/t25-,27+/m0/s1 |
| InChIKey | QAWJTXRQNZCZHM-AHKZPQOWSA-N |
| XLogP | 5.47 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|