About 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine
4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine (PubChem CID 666771) has the molecular formula C19H29NO3
and a molecular weight of 319.45 g/mol. Its IUPAC name is 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine.
Molecular Properties
| Compound Name | 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine |
| PubChem CID | 666771 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine |
| SMILES | CC(C)CCC(CCN1CCOCC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H29NO3/c1-15(2)3-4-16(7-8-20-9-11-21-12-10-20)17-5-6-18-19(13-17)23-14-22-18/h5-6,13,15-16H,3-4,7-12,14H2,1-2H3 |
| InChIKey | SHROANCCKWVCHN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine?
The IUPAC name of 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine (CID 666771) is 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine.
What is the SMILES notation for 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine?
The canonical SMILES for 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine is CC(C)CCC(CCN1CCOCC1)c1ccc2c(c1)OCO2.
What is the InChIKey of 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine?
The InChIKey is SHROANCCKWVCHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29NO3/c1-15(2)3-4-16(7-8-20-9-11-21-12-10-20)17-5-6-18-19(13-17)23-14-22-18/h5-6,13,15-16H,3-4,7-12,14H2,1-2H3.
What are the key properties of 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine?
4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine has a molecular weight of 319.45 g/mol, XLogP of 3.66, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1,3-benzodioxol-5-yl)-6-methylheptyl]morpholine is sourced from PubChem (CID 666771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).