C24H28O2 — CID 66677458
[2,3,3-trimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)but-1-enyl] benzoate (PubChem CID 66677458) has the molecular formula C24H28O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is [2,3,3-trimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)but-1-enyl] benzoate.
| Compound Name | [2,3,3-trimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)but-1-enyl] benzoate |
|---|---|
| PubChem CID | 66677458 |
| Molecular Formula | C24H28O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | [2,3,3-trimethyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)but-1-enyl] benzoate |
| SMILES | CC(=C(OC(=O)c1ccccc1)C1CCCc2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C24H28O2/c1-17(24(2,3)4)22(26-23(25)19-12-6-5-7-13-19)21-16-10-14-18-11-8-9-15-20(18)21/h5-9,11-13,15,21H,10,14,16H2,1-4H3 |
| InChIKey | UOUXENOPNNGMHC-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|