C20H17N5O2 — CID 66677802
5-[(2-hydroxyphenyl)methylamino]-N-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 66677802) has the molecular formula C20H17N5O2 and a molecular weight of 359.39 g/mol. Its IUPAC name is 5-[(2-hydroxyphenyl)methylamino]-N-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[(2-hydroxyphenyl)methylamino]-N-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 66677802 |
| Molecular Formula | C20H17N5O2 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-[(2-hydroxyphenyl)methylamino]-N-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cnn2ccc(NCc3ccccc3O)nc12 |
| InChI | InChI=1S/C20H17N5O2/c26-17-9-5-4-6-14(17)12-21-18-10-11-25-19(24-18)16(13-22-25)20(27)23-15-7-2-1-3-8-15/h1-11,13,26H,12H2,(H,21,24)(H,23,27) |
| InChIKey | OUFDNDHVBJHSBH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|