About 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium
1,2,3,6-Tetrahydropyridazine-3,6-dione potassium (PubChem CID 66678021) has the molecular formula C4H4KN2O2
and a molecular weight of 151.19 g/mol.
Analyze 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium?
The IUPAC name of 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium (CID 66678021) is not available.
What is the SMILES notation for 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium?
The canonical SMILES for 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium is O=c1ccc(=O)[nH][nH]1.[K].
What is the InChIKey of 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium?
The InChIKey is SKBQCJCSMNKLRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.K/c7-3-1-2-4(8)6-5-3;/h1-2H,(H,5,7)(H,6,8);.
What are the key properties of 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium?
1,2,3,6-Tetrahydropyridazine-3,6-dione potassium has a molecular weight of 151.19 g/mol, XLogP of -1.32, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,6-Tetrahydropyridazine-3,6-dione potassium is sourced from PubChem (CID 66678021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).