About 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine
1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine (PubChem CID 66678177) has the molecular formula C18H38N3O2P
and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine.
Molecular Properties
| Compound Name | 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine |
| PubChem CID | 66678177 |
| Molecular Formula | C18H38N3O2P |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine |
| SMILES | CC(C)(C)COP(=O)(N1CCN(C2CCNCC2)CC1)C(C)(C)C |
| InChI | InChI=1S/C18H38N3O2P/c1-17(2,3)15-23-24(22,18(4,5)6)21-13-11-20(12-14-21)16-7-9-19-10-8-16/h16,19H,7-15H2,1-6H3 |
| InChIKey | OEFIZIWYNLINQI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine?
The IUPAC name of 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine (CID 66678177) is 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine.
What is the SMILES notation for 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine?
The canonical SMILES for 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine is CC(C)(C)COP(=O)(N1CCN(C2CCNCC2)CC1)C(C)(C)C.
What is the InChIKey of 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine?
The InChIKey is OEFIZIWYNLINQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38N3O2P/c1-17(2,3)15-23-24(22,18(4,5)6)21-13-11-20(12-14-21)16-7-9-19-10-8-16/h16,19H,7-15H2,1-6H3.
What are the key properties of 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine?
1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine has a molecular weight of 359.50 g/mol, XLogP of 3.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[tert-butyl(2,2-dimethylpropoxy)phosphoryl]-4-piperidin-4-ylpiperazine is sourced from PubChem (CID 66678177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).