About bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate
bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate (PubChem CID 66678641) has the molecular formula C40H42N4O4
and a molecular weight of 642.80 g/mol. Its IUPAC name is bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate.
Molecular Properties
| Compound Name | bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate |
| PubChem CID | 66678641 |
| Molecular Formula | C40H42N4O4 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate |
| SMILES | Cc1c(C)n(CC(CNc2ccccc2)OC(=O)C(=O)OC(CNc2ccccc2)Cn2c(C)c(C)c3ccccc32)c2ccccc12 |
| InChI | InChI=1S/C40H42N4O4/c1-27-29(3)43(37-21-13-11-19-35(27)37)25-33(23-41-31-15-7-5-8-16-31)47-39(45)40(46)48-34(24-42-32-17-9-6-10-18-32)26-44-30(4)28(2)36-20-12-14-22-38(36)44/h5-22,33-34,41-42H,23-26H2,1-4H3 |
| InChIKey | QROGOHLIPCQHBD-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate?
The IUPAC name of bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate (CID 66678641) is bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate.
What is the SMILES notation for bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate?
The canonical SMILES for bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate is Cc1c(C)n(CC(CNc2ccccc2)OC(=O)C(=O)OC(CNc2ccccc2)Cn2c(C)c(C)c3ccccc32)c2ccccc12.
What is the InChIKey of bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate?
The InChIKey is QROGOHLIPCQHBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H42N4O4/c1-27-29(3)43(37-21-13-11-19-35(27)37)25-33(23-41-31-15-7-5-8-16-31)47-39(45)40(46)48-34(24-42-32-17-9-6-10-18-32)26-44-30(4)28(2)36-20-12-14-22-38(36)44/h5-22,33-34,41-42H,23-26H2,1-4H3.
What are the key properties of bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate?
bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate has a molecular weight of 642.80 g/mol, XLogP of 7.58, 12 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[1-anilino-3-(2,3-dimethylindol-1-yl)propan-2-yl] oxalate is sourced from PubChem (CID 66678641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).