C30H36F2N2O2Si — CID 66678669
[2-(2,5-difluoro-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol (PubChem CID 66678669) has the molecular formula C30H36F2N2O2Si and a molecular weight of 522.71 g/mol. Its IUPAC name is [2-(2,5-difluoro-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol.
| Compound Name | [2-(2,5-difluoro-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
|---|---|
| PubChem CID | 66678669 |
| Molecular Formula | C30H36F2N2O2Si |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | [2-(2,5-difluoro-4-phenylmethoxyphenyl)-1-tri(propan-2-yl)silylpyrrolo[2,3-b]pyridin-3-yl]methanol |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1c(-c2cc(F)c(OCc3ccccc3)cc2F)c(CO)c2cccnc21 |
| InChI | InChI=1S/C30H36F2N2O2Si/c1-19(2)37(20(3)4,21(5)6)34-29(25(17-35)23-13-10-14-33-30(23)34)24-15-27(32)28(16-26(24)31)36-18-22-11-8-7-9-12-22/h7-16,19-21,35H,17-18H2,1-6H3 |
| InChIKey | FNNVUGXSOAGERC-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|