C17H20N2O5 — CID 66678739
5-amino-2-(1,3-dioxoisoindol-2-yl)-3,3,4,4-tetramethyl-5-oxopentanoic acid (PubChem CID 66678739) has the molecular formula C17H20N2O5 and a molecular weight of 332.36 g/mol. Its IUPAC name is 5-amino-2-(1,3-dioxoisoindol-2-yl)-3,3,4,4-tetramethyl-5-oxopentanoic acid.
| Compound Name | 5-amino-2-(1,3-dioxoisoindol-2-yl)-3,3,4,4-tetramethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 66678739 |
| Molecular Formula | C17H20N2O5 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 5-amino-2-(1,3-dioxoisoindol-2-yl)-3,3,4,4-tetramethyl-5-oxopentanoic acid |
| SMILES | CC(C)(C(N)=O)C(C)(C)C(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H20N2O5/c1-16(2,17(3,4)15(18)24)11(14(22)23)19-12(20)9-7-5-6-8-10(9)13(19)21/h5-8,11H,1-4H3,(H2,18,24)(H,22,23) |
| InChIKey | LZLBCYUVWOQWPY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|