C17H19NO6 — CID 66678764
4-(1,3-dioxoisoindol-2-yl)-2,2,3,3-tetramethylpentanedioic acid (PubChem CID 66678764) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-2,2,3,3-tetramethylpentanedioic acid.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-2,2,3,3-tetramethylpentanedioic acid |
|---|---|
| PubChem CID | 66678764 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-2,2,3,3-tetramethylpentanedioic acid |
| SMILES | CC(C)(C(=O)O)C(C)(C)C(C(=O)O)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H19NO6/c1-16(2,17(3,4)15(23)24)11(14(21)22)18-12(19)9-7-5-6-8-10(9)13(18)20/h5-8,11H,1-4H3,(H,21,22)(H,23,24) |
| InChIKey | YIBPKYOTBXVHIV-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|