About copper;bis(8-hydroxy-1H-quinolin-2-one)
copper;bis(8-hydroxy-1H-quinolin-2-one) (PubChem CID 66679069) has the molecular formula C18H14CuN2O4
and a molecular weight of 385.87 g/mol. Its IUPAC name is copper;bis(8-hydroxy-1H-quinolin-2-one).
Molecular Properties
| Compound Name | copper;bis(8-hydroxy-1H-quinolin-2-one) |
| PubChem CID | 66679069 |
| Molecular Formula | C18H14CuN2O4 |
| Molecular Weight | 385.87 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | copper;bis(8-hydroxy-1H-quinolin-2-one) |
| SMILES | O=c1ccc2cccc(O)c2[nH]1.O=c1ccc2cccc(O)c2[nH]1.[Cu] |
| InChI | InChI=1S/2C9H7NO2.Cu/c2*11-7-3-1-2-6-4-5-8(12)10-9(6)7;/h2*1-5,11H,(H,10,12); |
| InChIKey | OXCKTEUDHYNTGS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze copper;bis(8-hydroxy-1H-quinolin-2-one) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(8-hydroxy-1H-quinolin-2-one)?
The IUPAC name of copper;bis(8-hydroxy-1H-quinolin-2-one) (CID 66679069) is copper;bis(8-hydroxy-1H-quinolin-2-one).
What is the SMILES notation for copper;bis(8-hydroxy-1H-quinolin-2-one)?
The canonical SMILES for copper;bis(8-hydroxy-1H-quinolin-2-one) is O=c1ccc2cccc(O)c2[nH]1.O=c1ccc2cccc(O)c2[nH]1.[Cu].
What is the InChIKey of copper;bis(8-hydroxy-1H-quinolin-2-one)?
The InChIKey is OXCKTEUDHYNTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H7NO2.Cu/c2*11-7-3-1-2-6-4-5-8(12)10-9(6)7;/h2*1-5,11H,(H,10,12);.
What are the key properties of copper;bis(8-hydroxy-1H-quinolin-2-one)?
copper;bis(8-hydroxy-1H-quinolin-2-one) has a molecular weight of 385.87 g/mol, XLogP of 2.46, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(8-hydroxy-1H-quinolin-2-one) is sourced from PubChem (CID 66679069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).