C16H16F3NO3 — CID 66679133
2-[[4-(3,3,3-trifluoro-2-hydroxypropyl)anilino]methyl]benzene-1,4-diol (PubChem CID 66679133) has the molecular formula C16H16F3NO3 and a molecular weight of 327.30 g/mol. Its IUPAC name is 2-[[4-(3,3,3-trifluoro-2-hydroxypropyl)anilino]methyl]benzene-1,4-diol.
| Compound Name | 2-[[4-(3,3,3-trifluoro-2-hydroxypropyl)anilino]methyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 66679133 |
| Molecular Formula | C16H16F3NO3 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 2-[[4-(3,3,3-trifluoro-2-hydroxypropyl)anilino]methyl]benzene-1,4-diol |
| SMILES | Oc1ccc(O)c(CNc2ccc(CC(O)C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C16H16F3NO3/c17-16(18,19)15(23)7-10-1-3-12(4-2-10)20-9-11-8-13(21)5-6-14(11)22/h1-6,8,15,20-23H,7,9H2 |
| InChIKey | YAKLQPOTFPMOAI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|