C11H14BNO4 — CID 66679909
ethyl (3aR,6aS)-2-cyanato-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]borole-3-carboxylate (PubChem CID 66679909) has the molecular formula C11H14BNO4 and a molecular weight of 235.05 g/mol. Its IUPAC name is ethyl (3aR,6aS)-2-cyanato-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]borole-3-carboxylate.
| Compound Name | ethyl (3aR,6aS)-2-cyanato-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]borole-3-carboxylate |
|---|---|
| PubChem CID | 66679909 |
| Molecular Formula | C11H14BNO4 |
| Molecular Weight | 235.05 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | ethyl (3aR,6aS)-2-cyanato-6-oxo-1,3,3a,4,5,6a-hexahydrocyclopenta[c]borole-3-carboxylate |
| SMILES | CCOC(=O)C1B(OC#N)C[C@@H]2C(=O)CC[C@H]12 |
| InChI | InChI=1S/C11H14BNO4/c1-2-16-11(15)10-7-3-4-9(14)8(7)5-12(10)17-6-13/h7-8,10H,2-5H2,1H3/t7-,8-,10?/m0/s1 |
| InChIKey | KHEPMWGMBIFQPU-JIBHNJPVSA-N |
| XLogP | 1.02 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.05 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|