C16H23F2NO2 — CID 66680052
(3R,4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide (PubChem CID 66680052) has the molecular formula C16H23F2NO2 and a molecular weight of 299.36 g/mol. Its IUPAC name is (3R,4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide.
| Compound Name | (3R,4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide |
|---|---|
| PubChem CID | 66680052 |
| Molecular Formula | C16H23F2NO2 |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | (3R,4S)-2,2-difluoro-3-hydroxy-4-methyl-N-[(1S)-1-phenylethyl]heptanamide |
| SMILES | CCC[C@H](C)[C@@H](O)C(F)(F)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C16H23F2NO2/c1-4-8-11(2)14(20)16(17,18)15(21)19-12(3)13-9-6-5-7-10-13/h5-7,9-12,14,20H,4,8H2,1-3H3,(H,19,21)/t11-,12-,14+/m0/s1 |
| InChIKey | ZGROLKYUDWAXLS-SGMGOOAPSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |