About 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine
2,3-diethoxyphenol;5-methoxy-4-phenyltriazine (PubChem CID 66680700) has the molecular formula C20H23N3O4
and a molecular weight of 369.42 g/mol. Its IUPAC name is 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine.
Molecular Properties
| Compound Name | 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine |
| PubChem CID | 66680700 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine |
| SMILES | CCOc1cccc(O)c1OCC.COc1cnnnc1-c1ccccc1 |
| InChI | InChI=1S/C10H9N3O.C10H14O3/c1-14-9-7-11-13-12-10(9)8-5-3-2-4-6-8;1-3-12-9-7-5-6-8(11)10(9)13-4-2/h2-7H,1H3;5-7,11H,3-4H2,1-2H3 |
| InChIKey | YTDZIJMKLJLHHS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 86.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine?
The IUPAC name of 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine (CID 66680700) is 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine.
What is the SMILES notation for 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine?
The canonical SMILES for 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine is CCOc1cccc(O)c1OCC.COc1cnnnc1-c1ccccc1.
What is the InChIKey of 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine?
The InChIKey is YTDZIJMKLJLHHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O.C10H14O3/c1-14-9-7-11-13-12-10(9)8-5-3-2-4-6-8;1-3-12-9-7-5-6-8(11)10(9)13-4-2/h2-7H,1H3;5-7,11H,3-4H2,1-2H3.
What are the key properties of 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine?
2,3-diethoxyphenol;5-methoxy-4-phenyltriazine has a molecular weight of 369.42 g/mol, XLogP of 3.74, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethoxyphenol;5-methoxy-4-phenyltriazine is sourced from PubChem (CID 66680700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).