About benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid
benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid (PubChem CID 66681717) has the molecular formula C21H37NO4Si
and a molecular weight of 395.62 g/mol. Its IUPAC name is benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid.
Molecular Properties
| Compound Name | benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid |
| PubChem CID | 66681717 |
| Molecular Formula | C21H37NO4Si |
| Molecular Weight | 395.62 g/mol |
| Exact Mass | 395.25 |
| IUPAC Name | benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid |
| SMILES | CC(C)[Si](OC[C@H](O)[C@@H](C)N(Cc1ccccc1)C(=O)O)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H37NO4Si/c1-15(2)27(16(3)4,17(5)6)26-14-20(23)18(7)22(21(24)25)13-19-11-9-8-10-12-19/h8-12,15-18,20,23H,13-14H2,1-7H3,(H,24,25)/t18-,20+/m1/s1 |
| InChIKey | PRIRLZKAKNXDOG-QUCCMNQESA-N |
| XLogP | 5.11 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.62 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid?
The IUPAC name of benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid (CID 66681717) is benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid.
What is the SMILES notation for benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid?
The canonical SMILES for benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid is CC(C)[Si](OC[C@H](O)[C@@H](C)N(Cc1ccccc1)C(=O)O)(C(C)C)C(C)C.
What is the InChIKey of benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid?
The InChIKey is PRIRLZKAKNXDOG-QUCCMNQESA-N. The full InChI is InChI=1S/C21H37NO4Si/c1-15(2)27(16(3)4,17(5)6)26-14-20(23)18(7)22(21(24)25)13-19-11-9-8-10-12-19/h8-12,15-18,20,23H,13-14H2,1-7H3,(H,24,25)/t18-,20+/m1/s1.
What are the key properties of benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid?
benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid has a molecular weight of 395.62 g/mol, XLogP of 5.11, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-[(2R,3R)-3-hydroxy-4-tri(propan-2-yl)silyloxybutan-2-yl]carbamic acid is sourced from PubChem (CID 66681717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).