C9H12F3NO4 — CID 66682741
(2E)-2-piperidin-3-ylideneacetic acid;2,2,2-trifluoroacetic acid (PubChem CID 66682741) has the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. Its IUPAC name is (2E)-2-piperidin-3-ylideneacetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2E)-2-piperidin-3-ylideneacetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66682741 |
| Molecular Formula | C9H12F3NO4 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (2E)-2-piperidin-3-ylideneacetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)/C=C1\CCCNC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H11NO2.C2HF3O2/c9-7(10)4-6-2-1-3-8-5-6;3-2(4,5)1(6)7/h4,8H,1-3,5H2,(H,9,10);(H,6,7)/b6-4+; |
| InChIKey | VADWAGZQYHIIOS-CVDVRWGVSA-N |
| XLogP | 1.01 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|