About benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone
benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone (PubChem CID 66682845) has the molecular formula C12H14N4O2
and a molecular weight of 246.27 g/mol. Its IUPAC name is benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone.
Molecular Properties
| Compound Name | benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone |
| PubChem CID | 66682845 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone |
| SMILES | CC1(C)OCCN1C(=O)n1nnc2ccccc21 |
| InChI | InChI=1S/C12H14N4O2/c1-12(2)15(7-8-18-12)11(17)16-10-6-4-3-5-9(10)13-14-16/h3-6H,7-8H2,1-2H3 |
| InChIKey | AZCIMIBMAANLMT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone?
The IUPAC name of benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone (CID 66682845) is benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone.
What is the SMILES notation for benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone?
The canonical SMILES for benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone is CC1(C)OCCN1C(=O)n1nnc2ccccc21.
What is the InChIKey of benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone?
The InChIKey is AZCIMIBMAANLMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2/c1-12(2)15(7-8-18-12)11(17)16-10-6-4-3-5-9(10)13-14-16/h3-6H,7-8H2,1-2H3.
What are the key properties of benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone?
benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone has a molecular weight of 246.27 g/mol, XLogP of 1.47, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl-(2,2-dimethyl-1,3-oxazolidin-3-yl)methanone is sourced from PubChem (CID 66682845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).