C33H47NO12 — CID 6668290
3-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-(1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbonyl)-3,4-dihydro-2H-pyran-4-yl]chromen-4-one (PubChem CID 6668290) has the molecular formula C33H47NO12 and a molecular weight of 649.73 g/mol. Its IUPAC name is 3-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-(1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbonyl)-3,4-dihydro-2H-pyran-4-yl]chromen-4-one.
| Compound Name | 3-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-(1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbonyl)-3,4-dihydro-2H-pyran-4-yl]chromen-4-one |
|---|---|
| PubChem CID | 6668290 |
| Molecular Formula | C33H47NO12 |
| Molecular Weight | 649.73 g/mol |
| Exact Mass | 649.31 |
| IUPAC Name | 3-[(2S,3S,4R)-2-ethoxy-3-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]-6-(1,4,7,10-tetraoxa-13-azacyclopentadecane-13-carbonyl)-3,4-dihydro-2H-pyran-4-yl]chromen-4-one |
| SMILES | CCO[C@H]1OC(C(=O)N2CCOCCOCCOCCOCC2)=C[C@@H](c2coc3ccccc3c2=O)[C@@H]1CCOCCOCCO |
| InChI | InChI=1S/C33H47NO12/c1-2-44-33-25(7-11-38-15-18-41-14-10-35)27(28-24-45-29-6-4-3-5-26(29)31(28)36)23-30(46-33)32(37)34-8-12-39-16-19-42-21-22-43-20-17-40-13-9-34/h3-6,23-25,27,33,35H,2,7-22H2,1H3/t25-,27+,33-/m0/s1 |
| InChIKey | SNLAKLCDYMREKU-PHZRBTHJSA-N |
| XLogP | 2.09 |
| TPSA | 144.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.73 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|