About tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane
tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane (PubChem CID 66683082) has the molecular formula C16H26N2SSi
and a molecular weight of 306.55 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane.
Molecular Properties
| Compound Name | tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane |
| PubChem CID | 66683082 |
| Molecular Formula | C16H26N2SSi |
| Molecular Weight | 306.55 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1cccc1-c1nccs1 |
| InChI | InChI=1S/C16H26N2SSi/c1-12(2)20(13(3)4,14(5)6)18-10-7-8-15(18)16-17-9-11-19-16/h7-14H,1-6H3 |
| InChIKey | WHSUAETWWHNQQM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane?
The IUPAC name of tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane (CID 66683082) is tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane.
What is the SMILES notation for tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane?
The canonical SMILES for tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane is CC(C)[Si](C(C)C)(C(C)C)n1cccc1-c1nccs1.
What is the InChIKey of tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane?
The InChIKey is WHSUAETWWHNQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2SSi/c1-12(2)20(13(3)4,14(5)6)18-10-7-8-15(18)16-17-9-11-19-16/h7-14H,1-6H3.
What are the key properties of tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane?
tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane has a molecular weight of 306.55 g/mol, XLogP of 5.64, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tri(propan-2-yl)-[2-(1,3-thiazol-2-yl)pyrrol-1-yl]silane is sourced from PubChem (CID 66683082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).