C15H14N2O4S — CID 666832
5-thiophen-2-yl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole (PubChem CID 666832) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 5-thiophen-2-yl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole.
| Compound Name | 5-thiophen-2-yl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 666832 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 5-thiophen-2-yl-3-(3,4,5-trimethoxyphenyl)-1,2,4-oxadiazole |
| SMILES | COc1cc(-c2noc(-c3cccs3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C15H14N2O4S/c1-18-10-7-9(8-11(19-2)13(10)20-3)14-16-15(21-17-14)12-5-4-6-22-12/h4-8H,1-3H3 |
| InChIKey | FBZAJSFJQICZTP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |