C22H24FNO2 — CID 66683449
4-[[4-(1-fluoroethyl)-2-pyridinyl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 66683449) has the molecular formula C22H24FNO2 and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[[4-(1-fluoroethyl)-2-pyridinyl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[[4-(1-fluoroethyl)-2-pyridinyl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 66683449 |
| Molecular Formula | C22H24FNO2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 4-[[4-(1-fluoroethyl)-2-pyridinyl]methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(Cc3cc(C(C)F)ccn3)C2=O)c(C)c1 |
| InChI | InChI=1S/C22H24FNO2/c1-12-7-13(2)20(14(3)8-12)21-19(25)11-17(22(21)26)10-18-9-16(15(4)23)5-6-24-18/h5-9,15,17,21H,10-11H2,1-4H3 |
| InChIKey | JPNOLAPTJSCCLD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|