C20H20FNO2 — CID 66683488
4-[(3-fluoro-2-pyridinyl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 66683488) has the molecular formula C20H20FNO2 and a molecular weight of 325.38 g/mol. Its IUPAC name is 4-[(3-fluoro-2-pyridinyl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | 4-[(3-fluoro-2-pyridinyl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 66683488 |
| Molecular Formula | C20H20FNO2 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 4-[(3-fluoro-2-pyridinyl)methyl]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(Cc3ncccc3F)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H20FNO2/c1-11-7-12(2)18(13(3)8-11)19-17(23)10-14(20(19)24)9-16-15(21)5-4-6-22-16/h4-8,14,19H,9-10H2,1-3H3 |
| InChIKey | RPGWDQIQOXHZEP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|