C8H13NO6 — CID 66683734
(3S,4R,5S,6R)-3-acetyl-3-amino-4,5,6-trihydroxyoxepan-2-one (PubChem CID 66683734) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is (3S,4R,5S,6R)-3-acetyl-3-amino-4,5,6-trihydroxyoxepan-2-one.
| Compound Name | (3S,4R,5S,6R)-3-acetyl-3-amino-4,5,6-trihydroxyoxepan-2-one |
|---|---|
| PubChem CID | 66683734 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (3S,4R,5S,6R)-3-acetyl-3-amino-4,5,6-trihydroxyoxepan-2-one |
| SMILES | CC(=O)[C@]1(N)C(=O)OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H13NO6/c1-3(10)8(9)6(13)5(12)4(11)2-15-7(8)14/h4-6,11-13H,2,9H2,1H3/t4-,5-,6+,8-/m1/s1 |
| InChIKey | DQICUVCRIIGUHS-MNCSTQPFSA-N |
| XLogP | -3.09 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|