C18H18FN3S — CID 66683749
6-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine (PubChem CID 66683749) has the molecular formula C18H18FN3S and a molecular weight of 327.43 g/mol. Its IUPAC name is 6-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine.
| Compound Name | 6-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine |
|---|---|
| PubChem CID | 66683749 |
| Molecular Formula | C18H18FN3S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 6-(2-fluoro-3-pyridinyl)spiro[2,3-dihydro-1H-naphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine |
| SMILES | NC1=NC2(CCCc3ccc(-c4cccnc4F)cc32)CCS1 |
| InChI | InChI=1S/C18H18FN3S/c19-16-14(4-2-9-21-16)13-6-5-12-3-1-7-18(15(12)11-13)8-10-23-17(20)22-18/h2,4-6,9,11H,1,3,7-8,10H2,(H2,20,22) |
| InChIKey | VVLNAIPUHNCAKB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|