C20H22ClN3S — CID 66683751
6-(5-chloro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine (PubChem CID 66683751) has the molecular formula C20H22ClN3S and a molecular weight of 371.94 g/mol. Its IUPAC name is 6-(5-chloro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine.
| Compound Name | 6-(5-chloro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine |
|---|---|
| PubChem CID | 66683751 |
| Molecular Formula | C20H22ClN3S |
| Molecular Weight | 371.94 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 6-(5-chloro-3-pyridinyl)-2,2-dimethylspiro[1,3-dihydronaphthalene-4,4'-5,6-dihydro-1,3-thiazine]-2'-amine |
| SMILES | CC1(C)Cc2ccc(-c3cncc(Cl)c3)cc2C2(CCSC(N)=N2)C1 |
| InChI | InChI=1S/C20H22ClN3S/c1-19(2)9-14-4-3-13(15-7-16(21)11-23-10-15)8-17(14)20(12-19)5-6-25-18(22)24-20/h3-4,7-8,10-11H,5-6,9,12H2,1-2H3,(H2,22,24) |
| InChIKey | NNOWXMJGJLIDEA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.94 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |