C20H20O2S — CID 66683884
(4E)-4-[(3-methylthiophen-2-yl)methylidene]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione (PubChem CID 66683884) has the molecular formula C20H20O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is (4E)-4-[(3-methylthiophen-2-yl)methylidene]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione.
| Compound Name | (4E)-4-[(3-methylthiophen-2-yl)methylidene]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 66683884 |
| Molecular Formula | C20H20O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | (4E)-4-[(3-methylthiophen-2-yl)methylidene]-2-(2,4,6-trimethylphenyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(C)c(C2C(=O)C/C(=C\c3sccc3C)C2=O)c(C)c1 |
| InChI | InChI=1S/C20H20O2S/c1-11-7-13(3)18(14(4)8-11)19-16(21)9-15(20(19)22)10-17-12(2)5-6-23-17/h5-8,10,19H,9H2,1-4H3/b15-10+ |
| InChIKey | QLVXJBQICJSRII-XNTDXEJSSA-N |
| XLogP | 4.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|