C28H31ClN2O6 — CID 6668423
(2R,4S)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-(4-hydroxybutoxy)-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide (PubChem CID 6668423) has the molecular formula C28H31ClN2O6 and a molecular weight of 527.02 g/mol. Its IUPAC name is (2R,4S)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-(4-hydroxybutoxy)-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide.
| Compound Name | (2R,4S)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-(4-hydroxybutoxy)-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
|---|---|
| PubChem CID | 6668423 |
| Molecular Formula | C28H31ClN2O6 |
| Molecular Weight | 527.02 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | (2R,4S)-N-[4-(5-chloro-1,3-dioxoisoindol-2-yl)-3-methylphenyl]-2-(4-hydroxybutoxy)-4-propan-2-yl-3,4-dihydro-2H-pyran-6-carboxamide |
| SMILES | Cc1cc(NC(=O)C2=C[C@H](C(C)C)C[C@H](OCCCCO)O2)ccc1N1C(=O)c2ccc(Cl)cc2C1=O |
| InChI | InChI=1S/C28H31ClN2O6/c1-16(2)18-13-24(37-25(14-18)36-11-5-4-10-32)26(33)30-20-7-9-23(17(3)12-20)31-27(34)21-8-6-19(29)15-22(21)28(31)35/h6-9,12-13,15-16,18,25,32H,4-5,10-11,14H2,1-3H3,(H,30,33)/t18-,25+/m0/s1 |
| InChIKey | PKBCFUQPHSHKSC-AVRWGWEMSA-N |
| XLogP | 5.08 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.02 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|